C21H21N5O2S — CID 90004215
(6S)-8-(1-methyl-2-oxoquinolin-5-yl)-13-methylsulfanyl-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one (PubChem CID 90004215) has the molecular formula C21H21N5O2S and a molecular weight of 407.50 g/mol. Its IUPAC name is (6S)-8-(1-methyl-2-oxoquinolin-5-yl)-13-methylsulfanyl-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one.
| Compound Name | (6S)-8-(1-methyl-2-oxoquinolin-5-yl)-13-methylsulfanyl-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
|---|---|
| PubChem CID | 90004215 |
| Molecular Formula | C21H21N5O2S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | (6S)-8-(1-methyl-2-oxoquinolin-5-yl)-13-methylsulfanyl-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
| SMILES | CSc1ncc2c(n1)N1CCC[C@H]1CN(c1cccc3c1ccc(=O)n3C)C2=O |
| InChI | InChI=1S/C21H21N5O2S/c1-24-16-6-3-7-17(14(16)8-9-18(24)27)26-12-13-5-4-10-25(13)19-15(20(26)28)11-22-21(23-19)29-2/h3,6-9,11,13H,4-5,10,12H2,1-2H3/t13-/m0/s1 |
| InChIKey | IRTLPALJHNSLIG-ZDUSSCGKSA-N |
| XLogP | 2.68 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |