C20H19N5OS — CID 90003469
(6S)-13-methylsulfanyl-8-quinolin-5-yl-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one (PubChem CID 90003469) has the molecular formula C20H19N5OS and a molecular weight of 377.47 g/mol. Its IUPAC name is (6S)-13-methylsulfanyl-8-quinolin-5-yl-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one.
| Compound Name | (6S)-13-methylsulfanyl-8-quinolin-5-yl-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
|---|---|
| PubChem CID | 90003469 |
| Molecular Formula | C20H19N5OS |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | (6S)-13-methylsulfanyl-8-quinolin-5-yl-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
| SMILES | CSc1ncc2c(n1)N1CCC[C@H]1CN(c1cccc3ncccc13)C2=O |
| InChI | InChI=1S/C20H19N5OS/c1-27-20-22-11-15-18(23-20)24-10-4-5-13(24)12-25(19(15)26)17-8-2-7-16-14(17)6-3-9-21-16/h2-3,6-9,11,13H,4-5,10,12H2,1H3/t13-/m0/s1 |
| InChIKey | UYAUJEKMSSZJIQ-ZDUSSCGKSA-N |
| XLogP | 3.38 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |