C20H20N6O2S2 — CID 91206717
13-methylsulfanyl-8-[3-(4-methyl-5-sulfanylidene-1,2,4-oxadiazol-3-yl)phenyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one (PubChem CID 91206717) has the molecular formula C20H20N6O2S2 and a molecular weight of 440.55 g/mol. Its IUPAC name is 13-methylsulfanyl-8-[3-(4-methyl-5-sulfanylidene-1,2,4-oxadiazol-3-yl)phenyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one.
| Compound Name | 13-methylsulfanyl-8-[3-(4-methyl-5-sulfanylidene-1,2,4-oxadiazol-3-yl)phenyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
|---|---|
| PubChem CID | 91206717 |
| Molecular Formula | C20H20N6O2S2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 13-methylsulfanyl-8-[3-(4-methyl-5-sulfanylidene-1,2,4-oxadiazol-3-yl)phenyl]-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
| SMILES | CSc1ncc2c(n1)N1CCCC1CN(c1cccc(-c3noc(=S)n3C)c1)C2=O |
| InChI | InChI=1S/C20H20N6O2S2/c1-24-16(23-28-20(24)29)12-5-3-6-13(9-12)26-11-14-7-4-8-25(14)17-15(18(26)27)10-21-19(22-17)30-2/h3,5-6,9-10,14H,4,7-8,11H2,1-2H3 |
| InChIKey | VXHDLFFBCRTXEY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|