C19H21N5O2S — CID 67351566
N-methyl-3-(13-methylsulfanyl-9-oxo-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-8-yl)benzamide (PubChem CID 67351566) has the molecular formula C19H21N5O2S and a molecular weight of 383.48 g/mol. Its IUPAC name is N-methyl-3-(13-methylsulfanyl-9-oxo-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-8-yl)benzamide.
| Compound Name | N-methyl-3-(13-methylsulfanyl-9-oxo-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-8-yl)benzamide |
|---|---|
| PubChem CID | 67351566 |
| Molecular Formula | C19H21N5O2S |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | N-methyl-3-(13-methylsulfanyl-9-oxo-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-8-yl)benzamide |
| SMILES | CNC(=O)c1cccc(N2CC3CCCN3c3nc(SC)ncc3C2=O)c1 |
| InChI | InChI=1S/C19H21N5O2S/c1-20-17(25)12-5-3-6-13(9-12)24-11-14-7-4-8-23(14)16-15(18(24)26)10-21-19(22-16)27-2/h3,5-6,9-10,14H,4,7-8,11H2,1-2H3,(H,20,25) |
| InChIKey | MPRKWRBFWFPBTL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |