C39H44F2N4O4 — CID 90048398
1-N'-[5-fluoro-4-[2-[6-methoxy-7-(5-morpholin-4-ylpentyl)quinolin-4-yl]ethyl]-2-methylphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 90048398) has the molecular formula C39H44F2N4O4 and a molecular weight of 670.80 g/mol. Its IUPAC name is 1-N'-[5-fluoro-4-[2-[6-methoxy-7-(5-morpholin-4-ylpentyl)quinolin-4-yl]ethyl]-2-methylphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[5-fluoro-4-[2-[6-methoxy-7-(5-morpholin-4-ylpentyl)quinolin-4-yl]ethyl]-2-methylphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 90048398 |
| Molecular Formula | C39H44F2N4O4 |
| Molecular Weight | 670.80 g/mol |
| Exact Mass | 670.33 |
| IUPAC Name | 1-N'-[5-fluoro-4-[2-[6-methoxy-7-(5-morpholin-4-ylpentyl)quinolin-4-yl]ethyl]-2-methylphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | COc1cc2c(CCc3cc(C)c(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)cc3F)ccnc2cc1CCCCCN1CCOCC1 |
| InChI | InChI=1S/C39H44F2N4O4/c1-26-22-28(33(41)25-34(26)44-38(47)39(14-15-39)37(46)43-31-11-9-30(40)10-12-31)8-7-27-13-16-42-35-23-29(36(48-2)24-32(27)35)6-4-3-5-17-45-18-20-49-21-19-45/h9-13,16,22-25H,3-8,14-15,17-21H2,1-2H3,(H,43,46)(H,44,47) |
| InChIKey | CWYCXHUAAYVVOZ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.80 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|