About CID 90088749
CID 90088749 (PubChem CID 90088749) has the molecular formula C12H11BN8O5P+
and a molecular weight of 389.06 g/mol.
Molecular Properties
| Compound Name | CID 90088749 |
| PubChem CID | 90088749 |
| Molecular Formula | C12H11BN8O5P+ |
| Molecular Weight | 389.06 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | — |
| SMILES | [B][P+]1(O)OC[C@H]2O[C@@H](n3c(N=[N+]=[N-])nc4c3ncn3ccnc43)[C@@H](O)[C@H]2O1 |
| InChI | InChI=1S/C12H11BN8O5P/c13-27(23)24-3-5-8(26-27)7(22)11(25-5)21-10-6(17-12(21)18-19-14)9-15-1-2-20(9)4-16-10/h1-2,4-5,7-8,11,22-23H,3H2/q+1/t5-,7+,8+,11-,27?/m1/s1 |
| InChIKey | KICACCCPUKQXLU-OICIFCBPSA-N |
| XLogP | 0.53 |
| TPSA | 164.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.06 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 90088749 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90088749?
The IUPAC name of CID 90088749 (CID 90088749) is not available.
What is the SMILES notation for CID 90088749?
The canonical SMILES for CID 90088749 is [B][P+]1(O)OC[C@H]2O[C@@H](n3c(N=[N+]=[N-])nc4c3ncn3ccnc43)[C@@H](O)[C@H]2O1.
What is the InChIKey of CID 90088749?
The InChIKey is KICACCCPUKQXLU-OICIFCBPSA-N. The full InChI is InChI=1S/C12H11BN8O5P/c13-27(23)24-3-5-8(26-27)7(22)11(25-5)21-10-6(17-12(21)18-19-14)9-15-1-2-20(9)4-16-10/h1-2,4-5,7-8,11,22-23H,3H2/q+1/t5-,7+,8+,11-,27?/m1/s1.
What are the key properties of CID 90088749?
CID 90088749 has a molecular weight of 389.06 g/mol, XLogP of 0.53, 2 rotatable bonds, 2 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90088749 is sourced from PubChem (CID 90088749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).