C15H25N3O12 — CID 90094298
bis[2-[bis(carboxymethyl)amino]ethyl]-(carboxymethyl)azanium formate (PubChem CID 90094298) has the molecular formula C15H25N3O12 and a molecular weight of 439.37 g/mol. Its IUPAC name is bis[2-[bis(carboxymethyl)amino]ethyl]-(carboxymethyl)azanium formate.
| Compound Name | bis[2-[bis(carboxymethyl)amino]ethyl]-(carboxymethyl)azanium formate |
|---|---|
| PubChem CID | 90094298 |
| Molecular Formula | C15H25N3O12 |
| Molecular Weight | 439.37 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | bis[2-[bis(carboxymethyl)amino]ethyl]-(carboxymethyl)azanium formate |
| SMILES | O=C(O)CN(CC[NH+](CCN(CC(=O)O)CC(=O)O)CC(=O)O)CC(=O)O.O=C[O-] |
| InChI | InChI=1S/C14H23N3O10.CH2O2/c18-10(19)5-15(1-3-16(6-11(20)21)7-12(22)23)2-4-17(8-13(24)25)9-14(26)27;2-1-3/h1-9H2,(H,18,19)(H,20,21)(H,22,23)(H,24,25)(H,26,27);1H,(H,2,3) |
| InChIKey | OWPYWAUIWCTNHV-UHFFFAOYSA-N |
| XLogP | -5.74 |
| TPSA | 237.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.37 |
| LogP ≤ 5 | -5.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|