C10H17BrN2O8 — CID 90095080
2-[bis(carboxymethyl)amino]ethyl-bis(carboxymethyl)azanium bromide (PubChem CID 90095080) has the molecular formula C10H17BrN2O8 and a molecular weight of 373.16 g/mol. Its IUPAC name is 2-[bis(carboxymethyl)amino]ethyl-bis(carboxymethyl)azanium bromide.
| Compound Name | 2-[bis(carboxymethyl)amino]ethyl-bis(carboxymethyl)azanium bromide |
|---|---|
| PubChem CID | 90095080 |
| Molecular Formula | C10H17BrN2O8 |
| Molecular Weight | 373.16 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | 2-[bis(carboxymethyl)amino]ethyl-bis(carboxymethyl)azanium bromide |
| SMILES | O=C(O)CN(CC[NH+](CC(=O)O)CC(=O)O)CC(=O)O.[Br-] |
| InChI | InChI=1S/C10H16N2O8.BrH/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);1H |
| InChIKey | LTUWQEHKQVPDBL-UHFFFAOYSA-N |
| XLogP | -6.48 |
| TPSA | 156.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.16 |
| LogP ≤ 5 | -6.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |