C19H12F12I2N2O2 — CID 90195786
2-[2-amino-5-[[4-amino-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-iodophenyl]methyl]-4-iodophenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 90195786) has the molecular formula C19H12F12I2N2O2 and a molecular weight of 782.10 g/mol. Its IUPAC name is 2-[2-amino-5-[[4-amino-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-iodophenyl]methyl]-4-iodophenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[2-amino-5-[[4-amino-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-iodophenyl]methyl]-4-iodophenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 90195786 |
| Molecular Formula | C19H12F12I2N2O2 |
| Molecular Weight | 782.10 g/mol |
| Exact Mass | 781.88 |
| IUPAC Name | 2-[2-amino-5-[[4-amino-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-iodophenyl]methyl]-4-iodophenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Nc1cc(I)c(Cc2cc(C(O)(C(F)(F)F)C(F)(F)F)c(N)cc2I)cc1C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H12F12I2N2O2/c20-16(21,22)14(36,17(23,24)25)8-2-6(10(32)4-12(8)34)1-7-3-9(13(35)5-11(7)33)15(37,18(26,27)28)19(29,30)31/h2-5,36-37H,1,34-35H2 |
| InChIKey | CEOCZNMBPUCAKE-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.10 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|