C14H17N4NaO5 — CID 90203083
sodium 5-[2-(2,3,4-trimethoxyanilino)ethyl]-1H-1,2,4-triazole-3-carboxylate (PubChem CID 90203083) has the molecular formula C14H17N4NaO5 and a molecular weight of 344.30 g/mol. Its IUPAC name is sodium 5-[2-(2,3,4-trimethoxyanilino)ethyl]-1H-1,2,4-triazole-3-carboxylate.
| Compound Name | sodium 5-[2-(2,3,4-trimethoxyanilino)ethyl]-1H-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 90203083 |
| Molecular Formula | C14H17N4NaO5 |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | sodium 5-[2-(2,3,4-trimethoxyanilino)ethyl]-1H-1,2,4-triazole-3-carboxylate |
| SMILES | COc1ccc(NCCc2nc(C(=O)[O-])n[nH]2)c(OC)c1OC.[Na+] |
| InChI | InChI=1S/C14H18N4O5.Na/c1-21-9-5-4-8(11(22-2)12(9)23-3)15-7-6-10-16-13(14(19)20)18-17-10;/h4-5,15H,6-7H2,1-3H3,(H,19,20)(H,16,17,18);/q;+1/p-1 |
| InChIKey | MDJUMFINKNBSTG-UHFFFAOYSA-M |
| XLogP | -3.15 |
| TPSA | 121.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|