C19H17BrCl6N4O4 — CID 90232812
2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-3-bromo-N-(1-ethoxy-2-oxoethyl)anilino]-2-ethoxyacetaldehyde (PubChem CID 90232812) has the molecular formula C19H17BrCl6N4O4 and a molecular weight of 657.99 g/mol. Its IUPAC name is 2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-3-bromo-N-(1-ethoxy-2-oxoethyl)anilino]-2-ethoxyacetaldehyde.
| Compound Name | 2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-3-bromo-N-(1-ethoxy-2-oxoethyl)anilino]-2-ethoxyacetaldehyde |
|---|---|
| PubChem CID | 90232812 |
| Molecular Formula | C19H17BrCl6N4O4 |
| Molecular Weight | 657.99 g/mol |
| Exact Mass | 653.86 |
| IUPAC Name | 2-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-3-bromo-N-(1-ethoxy-2-oxoethyl)anilino]-2-ethoxyacetaldehyde |
| SMILES | CCOC(C=O)N(c1ccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)c(Br)c1)C(C=O)OCC |
| InChI | InChI=1S/C19H17BrCl6N4O4/c1-3-33-13(8-31)30(14(9-32)34-4-2)10-5-6-11(12(20)7-10)15-27-16(18(21,22)23)29-17(28-15)19(24,25)26/h5-9,13-14H,3-4H2,1-2H3 |
| InChIKey | OFSMORTUCHBTPH-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 94.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.99 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|