C23H48N2O+2 — CID 90242287
1,3-bis(1,3,4-triethylpyrrolidin-1-ium-1-yl)propan-1-ol (PubChem CID 90242287) has the molecular formula C23H48N2O+2 and a molecular weight of 368.65 g/mol. Its IUPAC name is 1,3-bis(1,3,4-triethylpyrrolidin-1-ium-1-yl)propan-1-ol.
| Compound Name | 1,3-bis(1,3,4-triethylpyrrolidin-1-ium-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 90242287 |
| Molecular Formula | C23H48N2O+2 |
| Molecular Weight | 368.65 g/mol |
| Exact Mass | 368.38 |
| IUPAC Name | 1,3-bis(1,3,4-triethylpyrrolidin-1-ium-1-yl)propan-1-ol |
| SMILES | CCC1C[N+](CC)(CCC(O)[N+]2(CC)CC(CC)C(CC)C2)CC1CC |
| InChI | InChI=1S/C23H48N2O/c1-7-19-15-24(11-5,16-20(19)8-2)14-13-23(26)25(12-6)17-21(9-3)22(10-4)18-25/h19-23,26H,7-18H2,1-6H3/q+2 |
| InChIKey | QUWOVCYVRAXXGH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.65 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|