C25H32N2O12 — CID 90334327
methyl 6-[4-[2-[4-(ethoxycarbonylamino)butylamino]-2-oxoethyl]-2-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylate (PubChem CID 90334327) has the molecular formula C25H32N2O12 and a molecular weight of 552.53 g/mol. Its IUPAC name is methyl 6-[4-[2-[4-(ethoxycarbonylamino)butylamino]-2-oxoethyl]-2-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylate.
| Compound Name | methyl 6-[4-[2-[4-(ethoxycarbonylamino)butylamino]-2-oxoethyl]-2-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 90334327 |
| Molecular Formula | C25H32N2O12 |
| Molecular Weight | 552.53 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | methyl 6-[4-[2-[4-(ethoxycarbonylamino)butylamino]-2-oxoethyl]-2-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylate |
| SMILES | CCOC(=O)NCCCCNC(=O)Cc1cc(=O)oc2cc(OC3OC(C(=O)OC)C(O)C(O)C3O)ccc12 |
| InChI | InChI=1S/C25H32N2O12/c1-3-36-25(34)27-9-5-4-8-26-17(28)10-13-11-18(29)38-16-12-14(6-7-15(13)16)37-24-21(32)19(30)20(31)22(39-24)23(33)35-2/h6-7,11-12,19-22,24,30-32H,3-5,8-10H2,1-2H3,(H,26,28)(H,27,34) |
| InChIKey | QKTDRRAUYLHVRB-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 203.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.53 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|