C29H55NO6 — CID 90352369
5-[(2S,4R,5R)-5-[(2R,4S,5S)-6-[(2S)-butan-2-yl]-3,4,5-trimethyloxan-2-yl]oxy-6-[(4R)-1,3-dioxolan-4-yl]-2,4-dimethyloxan-2-yl]oxy-N,N-dimethylpentan-1-amine (PubChem CID 90352369) has the molecular formula C29H55NO6 and a molecular weight of 513.76 g/mol. Its IUPAC name is 5-[(2S,4R,5R)-5-[(2R,4S,5S)-6-[(2S)-butan-2-yl]-3,4,5-trimethyloxan-2-yl]oxy-6-[(4R)-1,3-dioxolan-4-yl]-2,4-dimethyloxan-2-yl]oxy-N,N-dimethylpentan-1-amine.
| Compound Name | 5-[(2S,4R,5R)-5-[(2R,4S,5S)-6-[(2S)-butan-2-yl]-3,4,5-trimethyloxan-2-yl]oxy-6-[(4R)-1,3-dioxolan-4-yl]-2,4-dimethyloxan-2-yl]oxy-N,N-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 90352369 |
| Molecular Formula | C29H55NO6 |
| Molecular Weight | 513.76 g/mol |
| Exact Mass | 513.40 |
| IUPAC Name | 5-[(2S,4R,5R)-5-[(2R,4S,5S)-6-[(2S)-butan-2-yl]-3,4,5-trimethyloxan-2-yl]oxy-6-[(4R)-1,3-dioxolan-4-yl]-2,4-dimethyloxan-2-yl]oxy-N,N-dimethylpentan-1-amine |
| SMILES | CC[C@H](C)C1O[C@H](O[C@H]2C([C@H]3COCO3)O[C@](C)(OCCCCCN(C)C)C[C@H]2C)C(C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C29H55NO6/c1-10-19(2)25-22(5)21(4)23(6)28(34-25)35-26-20(3)16-29(7,33-15-13-11-12-14-30(8)9)36-27(26)24-17-31-18-32-24/h19-28H,10-18H2,1-9H3/t19-,20+,21-,22-,23?,24+,25?,26+,27?,28+,29-/m0/s1 |
| InChIKey | ZWEBAIHGPISGFX-ZZNAAMHFSA-N |
| XLogP | 5.31 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.76 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|