C23H30N2O3Si — CID 90423990
1-[tert-butyl(diphenyl)silyl]oxy-3-[2-(hydroxymethyl)imidazol-1-yl]propan-2-ol (PubChem CID 90423990) has the molecular formula C23H30N2O3Si and a molecular weight of 410.59 g/mol. Its IUPAC name is 1-[tert-butyl(diphenyl)silyl]oxy-3-[2-(hydroxymethyl)imidazol-1-yl]propan-2-ol.
| Compound Name | 1-[tert-butyl(diphenyl)silyl]oxy-3-[2-(hydroxymethyl)imidazol-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 90423990 |
| Molecular Formula | C23H30N2O3Si |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 1-[tert-butyl(diphenyl)silyl]oxy-3-[2-(hydroxymethyl)imidazol-1-yl]propan-2-ol |
| SMILES | CC(C)(C)[Si](OCC(O)Cn1ccnc1CO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H30N2O3Si/c1-23(2,3)29(20-10-6-4-7-11-20,21-12-8-5-9-13-21)28-18-19(27)16-25-15-14-24-22(25)17-26/h4-15,19,26-27H,16-18H2,1-3H3 |
| InChIKey | VKVRLOXISRBNPT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|