C28H22F4N2O2 — CID 90426867
2,3,5,6-tetrafluoro-4-hydroxy-N-[2-(tritylamino)ethyl]benzamide (PubChem CID 90426867) has the molecular formula C28H22F4N2O2 and a molecular weight of 494.49 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-hydroxy-N-[2-(tritylamino)ethyl]benzamide.
| Compound Name | 2,3,5,6-tetrafluoro-4-hydroxy-N-[2-(tritylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 90426867 |
| Molecular Formula | C28H22F4N2O2 |
| Molecular Weight | 494.49 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-hydroxy-N-[2-(tritylamino)ethyl]benzamide |
| SMILES | O=C(NCCNC(c1ccccc1)(c1ccccc1)c1ccccc1)c1c(F)c(F)c(O)c(F)c1F |
| InChI | InChI=1S/C28H22F4N2O2/c29-22-21(23(30)25(32)26(35)24(22)31)27(36)33-16-17-34-28(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,34-35H,16-17H2,(H,33,36) |
| InChIKey | LZVWLNVAJALNMJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.49 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|