C33H36N4 — CID 90744695
2-(3-aminopentan-3-yl)-N-hexa-2,4-dien-2-yl-N-phenyl-5-(4-pyrimidin-5-ylphenyl)aniline (PubChem CID 90744695) has the molecular formula C33H36N4 and a molecular weight of 488.68 g/mol. Its IUPAC name is 2-(3-aminopentan-3-yl)-N-hexa-2,4-dien-2-yl-N-phenyl-5-(4-pyrimidin-5-ylphenyl)aniline.
| Compound Name | 2-(3-aminopentan-3-yl)-N-hexa-2,4-dien-2-yl-N-phenyl-5-(4-pyrimidin-5-ylphenyl)aniline |
|---|---|
| PubChem CID | 90744695 |
| Molecular Formula | C33H36N4 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | 2-(3-aminopentan-3-yl)-N-hexa-2,4-dien-2-yl-N-phenyl-5-(4-pyrimidin-5-ylphenyl)aniline |
| SMILES | CC=CC=C(C)N(c1ccccc1)c1cc(-c2ccc(-c3cncnc3)cc2)ccc1C(N)(CC)CC |
| InChI | InChI=1S/C33H36N4/c1-5-8-12-25(4)37(30-13-10-9-11-14-30)32-21-28(19-20-31(32)33(34,6-2)7-3)26-15-17-27(18-16-26)29-22-35-24-36-23-29/h5,8-24H,6-7,34H2,1-4H3 |
| InChIKey | NZYLUMLHFMHSBB-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|