C17H13Cl2F3N4O3 — CID 90811498
2-amino-2-[(3,5-dichloro-4-hydroxyphenyl)iminomethylimino]-N-[[3-(trifluoromethoxy)phenyl]methyl]acetamide (PubChem CID 90811498) has the molecular formula C17H13Cl2F3N4O3 and a molecular weight of 449.22 g/mol. Its IUPAC name is 2-amino-2-[(3,5-dichloro-4-hydroxyphenyl)iminomethylimino]-N-[[3-(trifluoromethoxy)phenyl]methyl]acetamide.
| Compound Name | 2-amino-2-[(3,5-dichloro-4-hydroxyphenyl)iminomethylimino]-N-[[3-(trifluoromethoxy)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 90811498 |
| Molecular Formula | C17H13Cl2F3N4O3 |
| Molecular Weight | 449.22 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | 2-amino-2-[(3,5-dichloro-4-hydroxyphenyl)iminomethylimino]-N-[[3-(trifluoromethoxy)phenyl]methyl]acetamide |
| SMILES | N/C(=N\C=N\c1cc(Cl)c(O)c(Cl)c1)C(=O)NCc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C17H13Cl2F3N4O3/c18-12-5-10(6-13(19)14(12)27)25-8-26-15(23)16(28)24-7-9-2-1-3-11(4-9)29-17(20,21)22/h1-6,8,27H,7H2,(H,24,28)(H2,23,25,26) |
| InChIKey | BYXDERKAANYBNL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.22 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|