C5H14N2S2 — CID 90830615
2,5-diaminopentane-1,3-dithiol (PubChem CID 90830615) has the molecular formula C5H14N2S2 and a molecular weight of 166.31 g/mol. Its IUPAC name is 2,5-diaminopentane-1,3-dithiol.
| Compound Name | 2,5-diaminopentane-1,3-dithiol |
|---|---|
| PubChem CID | 90830615 |
| Molecular Formula | C5H14N2S2 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 2,5-diaminopentane-1,3-dithiol |
| SMILES | NCCC(S)C(N)CS |
| InChI | InChI=1S/C5H14N2S2/c6-2-1-5(9)4(7)3-8/h4-5,8-9H,1-3,6-7H2 |
| InChIKey | FQFAGCAYGSDKPI-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|