C27H30ClF3N5O5+ — CID 90881958
(1R)-1-[[2-[[6-(4-aminobutoxy)-7-methoxyquinazolin-4-yl]amino]-4-chlorophenyl]methyl]-1-(2,2,2-trifluoroacetyl)pyrrolidin-1-ium-2-carboxylic acid (PubChem CID 90881958) has the molecular formula C27H30ClF3N5O5+ and a molecular weight of 597.01 g/mol. Its IUPAC name is (1R)-1-[[2-[[6-(4-aminobutoxy)-7-methoxyquinazolin-4-yl]amino]-4-chlorophenyl]methyl]-1-(2,2,2-trifluoroacetyl)pyrrolidin-1-ium-2-carboxylic acid.
| Compound Name | (1R)-1-[[2-[[6-(4-aminobutoxy)-7-methoxyquinazolin-4-yl]amino]-4-chlorophenyl]methyl]-1-(2,2,2-trifluoroacetyl)pyrrolidin-1-ium-2-carboxylic acid |
|---|---|
| PubChem CID | 90881958 |
| Molecular Formula | C27H30ClF3N5O5+ |
| Molecular Weight | 597.01 g/mol |
| Exact Mass | 596.19 |
| IUPAC Name | (1R)-1-[[2-[[6-(4-aminobutoxy)-7-methoxyquinazolin-4-yl]amino]-4-chlorophenyl]methyl]-1-(2,2,2-trifluoroacetyl)pyrrolidin-1-ium-2-carboxylic acid |
| SMILES | COc1cc2ncnc(Nc3cc(Cl)ccc3C[N@+]3(C(=O)C(F)(F)F)CCCC3C(=O)O)c2cc1OCCCCN |
| InChI | InChI=1S/C27H29ClF3N5O5/c1-40-22-13-20-18(12-23(22)41-10-3-2-8-32)24(34-15-33-20)35-19-11-17(28)7-6-16(19)14-36(26(39)27(29,30)31)9-4-5-21(36)25(37)38/h6-7,11-13,15,21H,2-5,8-10,14,32H2,1H3,(H-,33,34,35,37,38)/p+1/t21?,36-/m1/s1 |
| InChIKey | CPAAGVZXWDLMDT-SAXFSBPLSA-O |
| XLogP | 4.81 |
| TPSA | 136.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.01 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|