C24H31N3O3 — CID 90945311
3-[N-[4-[3-(dimethylamino)propyl]phenyl]-C-ethylcarbonimidoyl]-5,6-dimethoxy-1,3-dihydroindol-2-one (PubChem CID 90945311) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 3-[N-[4-[3-(dimethylamino)propyl]phenyl]-C-ethylcarbonimidoyl]-5,6-dimethoxy-1,3-dihydroindol-2-one.
| Compound Name | 3-[N-[4-[3-(dimethylamino)propyl]phenyl]-C-ethylcarbonimidoyl]-5,6-dimethoxy-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 90945311 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 3-[N-[4-[3-(dimethylamino)propyl]phenyl]-C-ethylcarbonimidoyl]-5,6-dimethoxy-1,3-dihydroindol-2-one |
| SMILES | CC/C(=N\c1ccc(CCCN(C)C)cc1)C1C(=O)Nc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C24H31N3O3/c1-6-19(25-17-11-9-16(10-12-17)8-7-13-27(2)3)23-18-14-21(29-4)22(30-5)15-20(18)26-24(23)28/h9-12,14-15,23H,6-8,13H2,1-5H3,(H,26,28)/b25-19+ |
| InChIKey | FKVCWTGYPLPRGZ-NCELDCMTSA-N |
| XLogP | 4.42 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|