(2-acetamidocyclohexyl) hydrogen sulfite

C8H15NO4S — CID 90958975

IUPAC(2-acetamidocyclohexyl) hydrogen sulfite
SMILESCC(=O)NC1CCCCC1OS(=O)O
InChIInChI=1S/C8H15NO4S/c1-6(10)9-7-4-2-3-5-8(7)13-14(11)12/h7-8H,2-5H2,1H3,(H,9,10)(H,11,12)
InChIKeyHWDNYWHLPGNCMT-UHFFFAOYSA-N
MW221.28 g/mol
LogP0.59
Rot. Bonds3

About (2-acetamidocyclohexyl) hydrogen sulfite

(2-acetamidocyclohexyl) hydrogen sulfite (PubChem CID 90958975) has the molecular formula C8H15NO4S and a molecular weight of 221.28 g/mol. Its IUPAC name is (2-acetamidocyclohexyl) hydrogen sulfite.

Molecular Properties

Compound Name(2-acetamidocyclohexyl) hydrogen sulfite
PubChem CID90958975
Molecular FormulaC8H15NO4S
Molecular Weight221.28 g/mol
Exact Mass221.07
IUPAC Name(2-acetamidocyclohexyl) hydrogen sulfite
SMILESCC(=O)NC1CCCCC1OS(=O)O
InChIInChI=1S/C8H15NO4S/c1-6(10)9-7-4-2-3-5-8(7)13-14(11)12/h7-8H,2-5H2,1H3,(H,9,10)(H,11,12)
InChIKeyHWDNYWHLPGNCMT-UHFFFAOYSA-N
XLogP0.59
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.28
LogP ≤ 50.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze (2-acetamidocyclohexyl) hydrogen sulfite with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-acetamidocyclohexyl) hydrogen sulfite?
The IUPAC name of (2-acetamidocyclohexyl) hydrogen sulfite (CID 90958975) is (2-acetamidocyclohexyl) hydrogen sulfite.
What is the SMILES notation for (2-acetamidocyclohexyl) hydrogen sulfite?
The canonical SMILES for (2-acetamidocyclohexyl) hydrogen sulfite is CC(=O)NC1CCCCC1OS(=O)O.
What is the InChIKey of (2-acetamidocyclohexyl) hydrogen sulfite?
The InChIKey is HWDNYWHLPGNCMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO4S/c1-6(10)9-7-4-2-3-5-8(7)13-14(11)12/h7-8H,2-5H2,1H3,(H,9,10)(H,11,12).
What are the key properties of (2-acetamidocyclohexyl) hydrogen sulfite?
(2-acetamidocyclohexyl) hydrogen sulfite has a molecular weight of 221.28 g/mol, XLogP of 0.59, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-acetamidocyclohexyl) hydrogen sulfite is sourced from PubChem (CID 90958975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).