About (2-acetamidocyclohexyl) hydrogen sulfite
(2-acetamidocyclohexyl) hydrogen sulfite (PubChem CID 90958975) has the molecular formula C8H15NO4S
and a molecular weight of 221.28 g/mol. Its IUPAC name is (2-acetamidocyclohexyl) hydrogen sulfite.
Molecular Properties
| Compound Name | (2-acetamidocyclohexyl) hydrogen sulfite |
| PubChem CID | 90958975 |
| Molecular Formula | C8H15NO4S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | (2-acetamidocyclohexyl) hydrogen sulfite |
| SMILES | CC(=O)NC1CCCCC1OS(=O)O |
| InChI | InChI=1S/C8H15NO4S/c1-6(10)9-7-4-2-3-5-8(7)13-14(11)12/h7-8H,2-5H2,1H3,(H,9,10)(H,11,12) |
| InChIKey | HWDNYWHLPGNCMT-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze (2-acetamidocyclohexyl) hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-acetamidocyclohexyl) hydrogen sulfite?
The IUPAC name of (2-acetamidocyclohexyl) hydrogen sulfite (CID 90958975) is (2-acetamidocyclohexyl) hydrogen sulfite.
What is the SMILES notation for (2-acetamidocyclohexyl) hydrogen sulfite?
The canonical SMILES for (2-acetamidocyclohexyl) hydrogen sulfite is CC(=O)NC1CCCCC1OS(=O)O.
What is the InChIKey of (2-acetamidocyclohexyl) hydrogen sulfite?
The InChIKey is HWDNYWHLPGNCMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO4S/c1-6(10)9-7-4-2-3-5-8(7)13-14(11)12/h7-8H,2-5H2,1H3,(H,9,10)(H,11,12).
What are the key properties of (2-acetamidocyclohexyl) hydrogen sulfite?
(2-acetamidocyclohexyl) hydrogen sulfite has a molecular weight of 221.28 g/mol, XLogP of 0.59, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-acetamidocyclohexyl) hydrogen sulfite is sourced from PubChem (CID 90958975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).