C27H29FN4O — CID 91109500
4-[4-[3-(2-aminoanilino)prop-1-enyl]-2-fluorophenyl]-1-methyl-N-phenylpyrrolidine-3-carboxamide (PubChem CID 91109500) has the molecular formula C27H29FN4O and a molecular weight of 444.55 g/mol. Its IUPAC name is 4-[4-[3-(2-aminoanilino)prop-1-enyl]-2-fluorophenyl]-1-methyl-N-phenylpyrrolidine-3-carboxamide.
| Compound Name | 4-[4-[3-(2-aminoanilino)prop-1-enyl]-2-fluorophenyl]-1-methyl-N-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 91109500 |
| Molecular Formula | C27H29FN4O |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 4-[4-[3-(2-aminoanilino)prop-1-enyl]-2-fluorophenyl]-1-methyl-N-phenylpyrrolidine-3-carboxamide |
| SMILES | CN1CC(C(=O)Nc2ccccc2)C(c2ccc(C=CCNc3ccccc3N)cc2F)C1 |
| InChI | InChI=1S/C27H29FN4O/c1-32-17-22(23(18-32)27(33)31-20-9-3-2-4-10-20)21-14-13-19(16-24(21)28)8-7-15-30-26-12-6-5-11-25(26)29/h2-14,16,22-23,30H,15,17-18,29H2,1H3,(H,31,33) |
| InChIKey | GFEJRYUCNOGYBQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|