C21H27F2NO6 — CID 91110351
6-(difluoromethylidene)-3,10,12-trihydroxy-5-methyl-1,11-dioxo-3,4,4a,5,5a,6a,7,8,9,10,10a,11a,12,12a-tetradecahydro-2H-tetracene-2-carboxamide (PubChem CID 91110351) has the molecular formula C21H27F2NO6 and a molecular weight of 427.44 g/mol. Its IUPAC name is 6-(difluoromethylidene)-3,10,12-trihydroxy-5-methyl-1,11-dioxo-3,4,4a,5,5a,6a,7,8,9,10,10a,11a,12,12a-tetradecahydro-2H-tetracene-2-carboxamide.
| Compound Name | 6-(difluoromethylidene)-3,10,12-trihydroxy-5-methyl-1,11-dioxo-3,4,4a,5,5a,6a,7,8,9,10,10a,11a,12,12a-tetradecahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 91110351 |
| Molecular Formula | C21H27F2NO6 |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 6-(difluoromethylidene)-3,10,12-trihydroxy-5-methyl-1,11-dioxo-3,4,4a,5,5a,6a,7,8,9,10,10a,11a,12,12a-tetradecahydro-2H-tetracene-2-carboxamide |
| SMILES | CC1C2CC(O)C(C(N)=O)C(=O)C2C(O)C2C(=O)C3C(O)CCCC3C(=C(F)F)C12 |
| InChI | InChI=1S/C21H27F2NO6/c1-6-8-5-10(26)15(21(24)30)18(28)14(8)19(29)16-11(6)13(20(22)23)7-3-2-4-9(25)12(7)17(16)27/h6-12,14-16,19,25-26,29H,2-5H2,1H3,(H2,24,30) |
| InChIKey | IJNYASQELDFBGM-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|