C18H23N3O5 — CID 90770091
7-amino-3-hydroxy-6-(2-iminoethyl)-10-methyl-1,8,9-trioxo-3,4,4a,5,8a,9a,10,10a-octahydro-2H-anthracene-2-carboxamide (PubChem CID 90770091) has the molecular formula C18H23N3O5 and a molecular weight of 361.40 g/mol. Its IUPAC name is 7-amino-3-hydroxy-6-(2-iminoethyl)-10-methyl-1,8,9-trioxo-3,4,4a,5,8a,9a,10,10a-octahydro-2H-anthracene-2-carboxamide.
| Compound Name | 7-amino-3-hydroxy-6-(2-iminoethyl)-10-methyl-1,8,9-trioxo-3,4,4a,5,8a,9a,10,10a-octahydro-2H-anthracene-2-carboxamide |
|---|---|
| PubChem CID | 90770091 |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 7-amino-3-hydroxy-6-(2-iminoethyl)-10-methyl-1,8,9-trioxo-3,4,4a,5,8a,9a,10,10a-octahydro-2H-anthracene-2-carboxamide |
| SMILES | [H]/N=C/CC1=C(N)C(=O)C2C(=O)C3C(=O)C(C(N)=O)C(O)CC3C(C)C2C1 |
| InChI | InChI=1S/C18H23N3O5/c1-6-8-4-7(2-3-19)14(20)17(25)12(8)15(23)11-9(6)5-10(22)13(16(11)24)18(21)26/h3,6,8-13,19,22H,2,4-5,20H2,1H3,(H2,21,26)/b19-3+ |
| InChIKey | GVPDJXBPCUJBSJ-QBROUFQSSA-N |
| XLogP | -0.67 |
| TPSA | 164.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|