C19H25Cl2NO7 — CID 160845798
3,10,12,12-tetrahydroxy-1,11-dioxo-3,4,4a,5,5a,6,6a,7,11a,12a-decahydro-2H-tetracene-2-carboxamide;dihydrochloride (PubChem CID 160845798) has the molecular formula C19H25Cl2NO7 and a molecular weight of 450.32 g/mol. Its IUPAC name is 3,10,12,12-tetrahydroxy-1,11-dioxo-3,4,4a,5,5a,6,6a,7,11a,12a-decahydro-2H-tetracene-2-carboxamide;dihydrochloride.
| Compound Name | 3,10,12,12-tetrahydroxy-1,11-dioxo-3,4,4a,5,5a,6,6a,7,11a,12a-decahydro-2H-tetracene-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 160845798 |
| Molecular Formula | C19H25Cl2NO7 |
| Molecular Weight | 450.32 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 3,10,12,12-tetrahydroxy-1,11-dioxo-3,4,4a,5,5a,6,6a,7,11a,12a-decahydro-2H-tetracene-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)C1C(=O)C2C(CC1O)CC1CC3CC=CC(O)=C3C(=O)C1C2(O)O |
| InChI | InChI=1S/C19H23NO7.2ClH/c20-18(25)13-11(22)6-9-5-8-4-7-2-1-3-10(21)12(7)16(23)14(8)19(26,27)15(9)17(13)24;;/h1,3,7-9,11,13-15,21-22,26-27H,2,4-6H2,(H2,20,25);2*1H |
| InChIKey | QBYNXWWPMCVQIP-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.32 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|