C19H23NO6 — CID 123138609
1,3-dihydroxy-10,11,12-trioxo-2,3,4,4a,5,5a,6,6a,7,10a,11a,12a-dodecahydro-1H-tetracene-2-carboxamide (PubChem CID 123138609) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is 1,3-dihydroxy-10,11,12-trioxo-2,3,4,4a,5,5a,6,6a,7,10a,11a,12a-dodecahydro-1H-tetracene-2-carboxamide.
| Compound Name | 1,3-dihydroxy-10,11,12-trioxo-2,3,4,4a,5,5a,6,6a,7,10a,11a,12a-dodecahydro-1H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 123138609 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 1,3-dihydroxy-10,11,12-trioxo-2,3,4,4a,5,5a,6,6a,7,10a,11a,12a-dodecahydro-1H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1C(O)CC2CC3CC4CC=CC(=O)C4C(=O)C3C(=O)C2C1O |
| InChI | InChI=1S/C19H23NO6/c20-19(26)15-11(22)6-9-5-8-4-7-2-1-3-10(21)12(7)16(23)13(8)17(24)14(9)18(15)25/h1,3,7-9,11-15,18,22,25H,2,4-6H2,(H2,20,26) |
| InChIKey | ALFCLQYUDUVKAI-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|