C16H14ClIN2O4S2 — CID 91151661
ethyl 6-chloro-1-(iodomethyl)-7-(thiophen-2-ylsulfonylamino)indole-2-carboxylate (PubChem CID 91151661) has the molecular formula C16H14ClIN2O4S2 and a molecular weight of 524.79 g/mol. Its IUPAC name is ethyl 6-chloro-1-(iodomethyl)-7-(thiophen-2-ylsulfonylamino)indole-2-carboxylate.
| Compound Name | ethyl 6-chloro-1-(iodomethyl)-7-(thiophen-2-ylsulfonylamino)indole-2-carboxylate |
|---|---|
| PubChem CID | 91151661 |
| Molecular Formula | C16H14ClIN2O4S2 |
| Molecular Weight | 524.79 g/mol |
| Exact Mass | 523.91 |
| IUPAC Name | ethyl 6-chloro-1-(iodomethyl)-7-(thiophen-2-ylsulfonylamino)indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2ccc(Cl)c(NS(=O)(=O)c3cccs3)c2n1CI |
| InChI | InChI=1S/C16H14ClIN2O4S2/c1-2-24-16(21)12-8-10-5-6-11(17)14(15(10)20(12)9-18)19-26(22,23)13-4-3-7-25-13/h3-8,19H,2,9H2,1H3 |
| InChIKey | ZJGWNRXJHDMXPS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.79 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|