(2R,3R,4S)-4-amino-2,3-dihydroxyheptanedioic acid

C7H13NO6 — CID 91155039

IUPAC(2R,3R,4S)-4-amino-2,3-dihydroxyheptanedioic acid
SMILESN[C@@H](CCC(=O)O)[C@@H](O)[C@@H](O)C(=O)O
InChIInChI=1S/C7H13NO6/c8-3(1-2-4(9)10)5(11)6(12)7(13)14/h3,5-6,11-12H,1-2,8H2,(H,9,10)(H,13,14)/t3-,5+,6+/m0/s1
InChIKeyCBPNDLTVNOPOQF-OTWZMJIISA-N
MW207.18 g/mol
LogP-2.02
Rot. Bonds6

About (2R,3R,4S)-4-amino-2,3-dihydroxyheptanedioic acid

(2R,3R,4S)-4-amino-2,3-dihydroxyheptanedioic acid (PubChem CID 91155039) has the molecular formula C7H13NO6 and a molecular weight of 207.18 g/mol. Its IUPAC name is (2R,3R,4S)-4-amino-2,3-dihydroxyheptanedioic acid.

Molecular Properties

Compound Name(2R,3R,4S)-4-amino-2,3-dihydroxyheptanedioic acid
PubChem CID91155039
Molecular FormulaC7H13NO6
Molecular Weight207.18 g/mol
Exact Mass207.07
IUPAC Name(2R,3R,4S)-4-amino-2,3-dihydroxyheptanedioic acid
SMILESN[C@@H](CCC(=O)O)[C@@H](O)[C@@H](O)C(=O)O
InChIInChI=1S/C7H13NO6/c8-3(1-2-4(9)10)5(11)6(12)7(13)14/h3,5-6,11-12H,1-2,8H2,(H,9,10)(H,13,14)/t3-,5+,6+/m0/s1
InChIKeyCBPNDLTVNOPOQF-OTWZMJIISA-N
XLogP-2.02
TPSA141.08 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.18
LogP ≤ 5-2.02
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Analyze (2R,3R,4S)-4-amino-2,3-dihydroxyheptanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R,3R,4S)-4-amino-2,3-dihydroxyheptanedioic acid?
The IUPAC name of (2R,3R,4S)-4-amino-2,3-dihydroxyheptanedioic acid (CID 91155039) is (2R,3R,4S)-4-amino-2,3-dihydroxyheptanedioic acid.
What is the SMILES notation for (2R,3R,4S)-4-amino-2,3-dihydroxyheptanedioic acid?
The canonical SMILES for (2R,3R,4S)-4-amino-2,3-dihydroxyheptanedioic acid is N[C@@H](CCC(=O)O)[C@@H](O)[C@@H](O)C(=O)O.
What is the InChIKey of (2R,3R,4S)-4-amino-2,3-dihydroxyheptanedioic acid?
The InChIKey is CBPNDLTVNOPOQF-OTWZMJIISA-N. The full InChI is InChI=1S/C7H13NO6/c8-3(1-2-4(9)10)5(11)6(12)7(13)14/h3,5-6,11-12H,1-2,8H2,(H,9,10)(H,13,14)/t3-,5+,6+/m0/s1.
What are the key properties of (2R,3R,4S)-4-amino-2,3-dihydroxyheptanedioic acid?
(2R,3R,4S)-4-amino-2,3-dihydroxyheptanedioic acid has a molecular weight of 207.18 g/mol, XLogP of -2.02, 6 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R,4S)-4-amino-2,3-dihydroxyheptanedioic acid is sourced from PubChem (CID 91155039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).