C7H13NO6 — CID 91155039
(2R,3R,4S)-4-amino-2,3-dihydroxyheptanedioic acid (PubChem CID 91155039) has the molecular formula C7H13NO6 and a molecular weight of 207.18 g/mol. Its IUPAC name is (2R,3R,4S)-4-amino-2,3-dihydroxyheptanedioic acid.
| Compound Name | (2R,3R,4S)-4-amino-2,3-dihydroxyheptanedioic acid |
|---|---|
| PubChem CID | 91155039 |
| Molecular Formula | C7H13NO6 |
| Molecular Weight | 207.18 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | (2R,3R,4S)-4-amino-2,3-dihydroxyheptanedioic acid |
| SMILES | N[C@@H](CCC(=O)O)[C@@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C7H13NO6/c8-3(1-2-4(9)10)5(11)6(12)7(13)14/h3,5-6,11-12H,1-2,8H2,(H,9,10)(H,13,14)/t3-,5+,6+/m0/s1 |
| InChIKey | CBPNDLTVNOPOQF-OTWZMJIISA-N |
| XLogP | -2.02 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.18 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |