C18H10F12O7S2-2 — CID 91184403
2-methyl-5-(2,2,2-trifluoroethoxy)benzenesulfonate;2,3,5-tris(trifluoromethyl)benzenesulfonate (PubChem CID 91184403) has the molecular formula C18H10F12O7S2-2 and a molecular weight of 630.38 g/mol. Its IUPAC name is 2-methyl-5-(2,2,2-trifluoroethoxy)benzenesulfonate;2,3,5-tris(trifluoromethyl)benzenesulfonate.
| Compound Name | 2-methyl-5-(2,2,2-trifluoroethoxy)benzenesulfonate;2,3,5-tris(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 91184403 |
| Molecular Formula | C18H10F12O7S2-2 |
| Molecular Weight | 630.38 g/mol |
| Exact Mass | 629.97 |
| IUPAC Name | 2-methyl-5-(2,2,2-trifluoroethoxy)benzenesulfonate;2,3,5-tris(trifluoromethyl)benzenesulfonate |
| SMILES | Cc1ccc(OCC(F)(F)F)cc1S(=O)(=O)[O-].O=S(=O)([O-])c1cc(C(F)(F)F)cc(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C9H3F9O3S.C9H9F3O4S/c10-7(11,12)3-1-4(8(13,14)15)6(9(16,17)18)5(2-3)22(19,20)21;1-6-2-3-7(16-5-9(10,11)12)4-8(6)17(13,14)15/h1-2H,(H,19,20,21);2-4H,5H2,1H3,(H,13,14,15)/p-2 |
| InChIKey | BRZPLRBIEKXOLW-UHFFFAOYSA-L |
| XLogP | 5.49 |
| TPSA | 123.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.38 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|