C17H14O3 — CID 91191073
5-oxo-4,5-diphenylpent-2-enoic acid (PubChem CID 91191073) has the molecular formula C17H14O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 5-oxo-4,5-diphenylpent-2-enoic acid.
| Compound Name | 5-oxo-4,5-diphenylpent-2-enoic acid |
|---|---|
| PubChem CID | 91191073 |
| Molecular Formula | C17H14O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 5-oxo-4,5-diphenylpent-2-enoic acid |
| SMILES | O=C(O)C=CC(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H14O3/c18-16(19)12-11-15(13-7-3-1-4-8-13)17(20)14-9-5-2-6-10-14/h1-12,15H,(H,18,19) |
| InChIKey | GUKMQDGNTHJBJU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|