C32H56 — CID 91232409
4-(4,5-dimethylhex-1-enyl)-6-ethyl-3,10-dimethyl-3-pent-2-enyl-10-propan-2-ylcyclododecyne (PubChem CID 91232409) has the molecular formula C32H56 and a molecular weight of 440.80 g/mol. Its IUPAC name is 4-(4,5-dimethylhex-1-enyl)-6-ethyl-3,10-dimethyl-3-pent-2-enyl-10-propan-2-ylcyclododecyne.
| Compound Name | 4-(4,5-dimethylhex-1-enyl)-6-ethyl-3,10-dimethyl-3-pent-2-enyl-10-propan-2-ylcyclododecyne |
|---|---|
| PubChem CID | 91232409 |
| Molecular Formula | C32H56 |
| Molecular Weight | 440.80 g/mol |
| Exact Mass | 440.44 |
| IUPAC Name | 4-(4,5-dimethylhex-1-enyl)-6-ethyl-3,10-dimethyl-3-pent-2-enyl-10-propan-2-ylcyclododecyne |
| SMILES | CCC=CCC1(C)C#CCCC(C)(C(C)C)CCCC(CC)CC1C=CCC(C)C(C)C |
| InChI | InChI=1S/C32H56/c1-10-12-13-22-32(9)23-15-14-21-31(8,27(5)6)24-17-19-29(11-2)25-30(32)20-16-18-28(7)26(3)4/h12-13,16,20,26-30H,10-11,14,17-19,21-22,24-25H2,1-9H3 |
| InChIKey | MOKWHNMVWKQWSU-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.80 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|