C29H31N3O9 — CID 91270131
(4R,4aS,5R,5aS,12aR)-9-(benzamidomethyl)-4-(dimethylamino)-3,5,10,12a-tetrahydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide (PubChem CID 91270131) has the molecular formula C29H31N3O9 and a molecular weight of 565.58 g/mol. Its IUPAC name is (4R,4aS,5R,5aS,12aR)-9-(benzamidomethyl)-4-(dimethylamino)-3,5,10,12a-tetrahydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aS,5R,5aS,12aR)-9-(benzamidomethyl)-4-(dimethylamino)-3,5,10,12a-tetrahydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91270131 |
| Molecular Formula | C29H31N3O9 |
| Molecular Weight | 565.58 g/mol |
| Exact Mass | 565.21 |
| IUPAC Name | (4R,4aS,5R,5aS,12aR)-9-(benzamidomethyl)-4-(dimethylamino)-3,5,10,12a-tetrahydroxy-1,11,12-trioxo-2,3,4,4a,5,5a,6,11a-octahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@H]1C(O)C(C(N)=O)C(=O)[C@]2(O)C(=O)C3C(=O)c4c(ccc(CNC(=O)c5ccccc5)c4O)C[C@@H]3[C@@H](O)[C@H]12 |
| InChI | InChI=1S/C29H31N3O9/c1-32(2)20-19-22(34)15-10-13-8-9-14(11-31-28(40)12-6-4-3-5-7-12)21(33)16(13)23(35)17(15)25(37)29(19,41)26(38)18(24(20)36)27(30)39/h3-9,15,17-20,22,24,33-34,36,41H,10-11H2,1-2H3,(H2,30,39)(H,31,40)/t15-,17?,18?,19-,20+,22+,24?,29+/m0/s1 |
| InChIKey | CHAXRZOWTPYYBL-WGTRLWGKSA-N |
| XLogP | -1.44 |
| TPSA | 207.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.58 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|