C22H31NO6S — CID 91414533
[2-ethoxy-2-[(13S)-2-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]acetyl]sulfamic acid (PubChem CID 91414533) has the molecular formula C22H31NO6S and a molecular weight of 437.56 g/mol. Its IUPAC name is [2-ethoxy-2-[(13S)-2-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]acetyl]sulfamic acid.
| Compound Name | [2-ethoxy-2-[(13S)-2-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]acetyl]sulfamic acid |
|---|---|
| PubChem CID | 91414533 |
| Molecular Formula | C22H31NO6S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | [2-ethoxy-2-[(13S)-2-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]acetyl]sulfamic acid |
| SMILES | CCOC(C(=O)NS(=O)(=O)O)c1cc2c(cc1O)C1CC[C@]3(C)CCCC3C1CC2 |
| InChI | InChI=1S/C22H31NO6S/c1-3-29-20(21(25)23-30(26,27)28)17-11-13-6-7-15-14(16(13)12-19(17)24)8-10-22(2)9-4-5-18(15)22/h11-12,14-15,18,20,24H,3-10H2,1-2H3,(H,23,25)(H,26,27,28)/t14?,15?,18?,20?,22-/m0/s1 |
| InChIKey | TTYCRXKAWJVTIX-HMYXACTGSA-N |
| XLogP | 3.63 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|