C19H35N5O3Si — CID 91425772
4-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]-2-ethoxyhexane-3,4-diol (PubChem CID 91425772) has the molecular formula C19H35N5O3Si and a molecular weight of 409.61 g/mol. Its IUPAC name is 4-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]-2-ethoxyhexane-3,4-diol.
| Compound Name | 4-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]-2-ethoxyhexane-3,4-diol |
|---|---|
| PubChem CID | 91425772 |
| Molecular Formula | C19H35N5O3Si |
| Molecular Weight | 409.61 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | 4-(6-aminopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]-2-ethoxyhexane-3,4-diol |
| SMILES | CCOC(C)C(O)(C(O)(CC)n1cnc2c(N)ncnc21)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H35N5O3Si/c1-9-18(25,24-12-23-14-15(20)21-11-22-16(14)24)19(26,13(3)27-10-2)28(7,8)17(4,5)6/h11-13,25-26H,9-10H2,1-8H3,(H2,20,21,22) |
| InChIKey | IUVJXCUTAQSPRJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.61 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|