C15H25OP — CID 91430477
(3,4-dibutyl-2-methylphenoxy)phosphane (PubChem CID 91430477) has the molecular formula C15H25OP and a molecular weight of 252.34 g/mol. Its IUPAC name is (3,4-dibutyl-2-methylphenoxy)phosphane.
| Compound Name | (3,4-dibutyl-2-methylphenoxy)phosphane |
|---|---|
| PubChem CID | 91430477 |
| Molecular Formula | C15H25OP |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | (3,4-dibutyl-2-methylphenoxy)phosphane |
| SMILES | CCCCc1ccc(OP)c(C)c1CCCC |
| InChI | InChI=1S/C15H25OP/c1-4-6-8-13-10-11-15(16-17)12(3)14(13)9-7-5-2/h10-11H,4-9,17H2,1-3H3 |
| InChIKey | GBLRRXPOTPYFAI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|