C19H25N7O4 — CID 91442188
1-carbamoylimino-3-[4-[6-(3-ethyl-4-methylanilino)-2,4-dioxo-1H-pyrimidin-3-yl]butyl]urea (PubChem CID 91442188) has the molecular formula C19H25N7O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is 1-carbamoylimino-3-[4-[6-(3-ethyl-4-methylanilino)-2,4-dioxo-1H-pyrimidin-3-yl]butyl]urea.
| Compound Name | 1-carbamoylimino-3-[4-[6-(3-ethyl-4-methylanilino)-2,4-dioxo-1H-pyrimidin-3-yl]butyl]urea |
|---|---|
| PubChem CID | 91442188 |
| Molecular Formula | C19H25N7O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 1-carbamoylimino-3-[4-[6-(3-ethyl-4-methylanilino)-2,4-dioxo-1H-pyrimidin-3-yl]butyl]urea |
| SMILES | CCc1cc(Nc2cc(=O)n(CCCCNC(=O)N=NC(N)=O)c(=O)[nH]2)ccc1C |
| InChI | InChI=1S/C19H25N7O4/c1-3-13-10-14(7-6-12(13)2)22-15-11-16(27)26(19(30)23-15)9-5-4-8-21-18(29)25-24-17(20)28/h6-7,10-11,22H,3-5,8-9H2,1-2H3,(H2,20,28)(H,21,29)(H,23,30) |
| InChIKey | LHXHMMXECMEKSH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 163.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|