C22H19Cl2N5O2 — CID 91479396
6-[2,6-dichloro-4-[1-(prop-2-enoxyamino)ethenyl]anilino]-8,9-dihydro-2H-pyrido[4,3-c][1,6]naphthyridin-1-one (PubChem CID 91479396) has the molecular formula C22H19Cl2N5O2 and a molecular weight of 456.33 g/mol. Its IUPAC name is 6-[2,6-dichloro-4-[1-(prop-2-enoxyamino)ethenyl]anilino]-8,9-dihydro-2H-pyrido[4,3-c][1,6]naphthyridin-1-one.
| Compound Name | 6-[2,6-dichloro-4-[1-(prop-2-enoxyamino)ethenyl]anilino]-8,9-dihydro-2H-pyrido[4,3-c][1,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 91479396 |
| Molecular Formula | C22H19Cl2N5O2 |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | 6-[2,6-dichloro-4-[1-(prop-2-enoxyamino)ethenyl]anilino]-8,9-dihydro-2H-pyrido[4,3-c][1,6]naphthyridin-1-one |
| SMILES | C=CCONC(=C)c1cc(Cl)c(Nc2nc3cc[nH]c(=O)c3c3c2=CCNC=3)c(Cl)c1 |
| InChI | InChI=1S/C22H19Cl2N5O2/c1-3-8-31-29-12(2)13-9-16(23)20(17(24)10-13)28-21-14-4-6-25-11-15(14)19-18(27-21)5-7-26-22(19)30/h3-5,7,9-11,25,29H,1-2,6,8H2,(H,26,30)(H,27,28) |
| InChIKey | SIJBBPAQOYCABS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 91.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|