C15H15F3N4O — CID 91511400
6-[[(2S)-1,1,1-trifluorobutan-2-yl]amino]-8,9-dihydro-2H-pyrido[4,3-c][1,6]naphthyridin-1-one (PubChem CID 91511400) has the molecular formula C15H15F3N4O and a molecular weight of 324.31 g/mol. Its IUPAC name is 6-[[(2S)-1,1,1-trifluorobutan-2-yl]amino]-8,9-dihydro-2H-pyrido[4,3-c][1,6]naphthyridin-1-one.
| Compound Name | 6-[[(2S)-1,1,1-trifluorobutan-2-yl]amino]-8,9-dihydro-2H-pyrido[4,3-c][1,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 91511400 |
| Molecular Formula | C15H15F3N4O |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 6-[[(2S)-1,1,1-trifluorobutan-2-yl]amino]-8,9-dihydro-2H-pyrido[4,3-c][1,6]naphthyridin-1-one |
| SMILES | CC[C@H](Nc1nc2cc[nH]c(=O)c2c2c1=CCNC=2)C(F)(F)F |
| InChI | InChI=1S/C15H15F3N4O/c1-2-11(15(16,17)18)22-13-8-3-5-19-7-9(8)12-10(21-13)4-6-20-14(12)23/h3-4,6-7,11,19H,2,5H2,1H3,(H,20,23)(H,21,22)/t11-/m0/s1 |
| InChIKey | YOZWITPNIHZKET-NSHDSACASA-N |
| XLogP | 0.80 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |