C5H12Br2N4 — CID 91493816
2-(4-aminobutyl)-1,1-dibromoguanidine (PubChem CID 91493816) has the molecular formula C5H12Br2N4 and a molecular weight of 287.99 g/mol. Its IUPAC name is 2-(4-aminobutyl)-1,1-dibromoguanidine.
| Compound Name | 2-(4-aminobutyl)-1,1-dibromoguanidine |
|---|---|
| PubChem CID | 91493816 |
| Molecular Formula | C5H12Br2N4 |
| Molecular Weight | 287.99 g/mol |
| Exact Mass | 285.94 |
| IUPAC Name | 2-(4-aminobutyl)-1,1-dibromoguanidine |
| SMILES | NCCCC/N=C(\N)N(Br)Br |
| InChI | InChI=1S/C5H12Br2N4/c6-11(7)5(9)10-4-2-1-3-8/h1-4,8H2,(H2,9,10) |
| InChIKey | PQKPWLQCBYKNPH-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.99 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|