C18H10Cl2NO4- — CID 9150445
4-[[5-(2,6-dichlorophenyl)furan-2-carbonyl]amino]benzoate (PubChem CID 9150445) has the molecular formula C18H10Cl2NO4- and a molecular weight of 375.19 g/mol. Its IUPAC name is 4-[[5-(2,6-dichlorophenyl)furan-2-carbonyl]amino]benzoate.
| Compound Name | 4-[[5-(2,6-dichlorophenyl)furan-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 9150445 |
| Molecular Formula | C18H10Cl2NO4- |
| Molecular Weight | 375.19 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | 4-[[5-(2,6-dichlorophenyl)furan-2-carbonyl]amino]benzoate |
| SMILES | O=C([O-])c1ccc(NC(=O)c2ccc(-c3c(Cl)cccc3Cl)o2)cc1 |
| InChI | InChI=1S/C18H11Cl2NO4/c19-12-2-1-3-13(20)16(12)14-8-9-15(25-14)17(22)21-11-6-4-10(5-7-11)18(23)24/h1-9H,(H,21,22)(H,23,24)/p-1 |
| InChIKey | AIDXOZGXTMGXND-UHFFFAOYSA-M |
| XLogP | 3.87 |
| TPSA | 82.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.19 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |