C23H23NO2 — CID 91569610
2-[(4aS,10aR)-7-hydroxy-4a-[(4-hydroxyphenyl)methyl]-1,3,4,9,10,10a-hexahydrophenanthren-2-ylidene]acetonitrile (PubChem CID 91569610) has the molecular formula C23H23NO2 and a molecular weight of 345.44 g/mol. Its IUPAC name is 2-[(4aS,10aR)-7-hydroxy-4a-[(4-hydroxyphenyl)methyl]-1,3,4,9,10,10a-hexahydrophenanthren-2-ylidene]acetonitrile.
| Compound Name | 2-[(4aS,10aR)-7-hydroxy-4a-[(4-hydroxyphenyl)methyl]-1,3,4,9,10,10a-hexahydrophenanthren-2-ylidene]acetonitrile |
|---|---|
| PubChem CID | 91569610 |
| Molecular Formula | C23H23NO2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 2-[(4aS,10aR)-7-hydroxy-4a-[(4-hydroxyphenyl)methyl]-1,3,4,9,10,10a-hexahydrophenanthren-2-ylidene]acetonitrile |
| SMILES | N#CC=C1CC[C@@]2(Cc3ccc(O)cc3)c3ccc(O)cc3CC[C@@H]2C1 |
| InChI | InChI=1S/C23H23NO2/c24-12-10-16-9-11-23(15-17-1-5-20(25)6-2-17)19(13-16)4-3-18-14-21(26)7-8-22(18)23/h1-2,5-8,10,14,19,25-26H,3-4,9,11,13,15H2/t19-,23+/m1/s1 |
| InChIKey | KQWCDIFSZKDBRZ-XXBNENTESA-N |
| XLogP | 4.77 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|