About dithiirane;propan-2-one
dithiirane;propan-2-one (PubChem CID 91573911) has the molecular formula C4H8OS2
and a molecular weight of 136.24 g/mol. Its IUPAC name is dithiirane;propan-2-one.
Molecular Properties
| Compound Name | dithiirane;propan-2-one |
| PubChem CID | 91573911 |
| Molecular Formula | C4H8OS2 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.00 |
| IUPAC Name | dithiirane;propan-2-one |
| SMILES | C1SS1.CC(C)=O |
| InChI | InChI=1S/C3H6O.CH2S2/c1-3(2)4;1-2-3-1/h1-2H3;1H2 |
| InChIKey | LTXMWDULFRERBL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze dithiirane;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dithiirane;propan-2-one?
The IUPAC name of dithiirane;propan-2-one (CID 91573911) is dithiirane;propan-2-one.
What is the SMILES notation for dithiirane;propan-2-one?
The canonical SMILES for dithiirane;propan-2-one is C1SS1.CC(C)=O.
What is the InChIKey of dithiirane;propan-2-one?
The InChIKey is LTXMWDULFRERBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.CH2S2/c1-3(2)4;1-2-3-1/h1-2H3;1H2.
What are the key properties of dithiirane;propan-2-one?
dithiirane;propan-2-one has a molecular weight of 136.24 g/mol, XLogP of 1.93, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dithiirane;propan-2-one is sourced from PubChem (CID 91573911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).