C12H30N2O16P4 — CID 91668036
bis(2-[bis(2-hydroxyethyl)amino]ethanol);2,4,6,8,9,10-hexaoxa-1λ5,3λ5,5λ5,7λ5-tetraphosphatricyclo[3.3.1.13,7]decane 1,3,5,7-tetraoxide (PubChem CID 91668036) has the molecular formula C12H30N2O16P4 and a molecular weight of 582.27 g/mol. Its IUPAC name is bis(2-[bis(2-hydroxyethyl)amino]ethanol);2,4,6,8,9,10-hexaoxa-1λ5,3λ5,5λ5,7λ5-tetraphosphatricyclo[3.3.1.13,7]decane 1,3,5,7-tetraoxide.
| Compound Name | bis(2-[bis(2-hydroxyethyl)amino]ethanol);2,4,6,8,9,10-hexaoxa-1λ5,3λ5,5λ5,7λ5-tetraphosphatricyclo[3.3.1.13,7]decane 1,3,5,7-tetraoxide |
|---|---|
| PubChem CID | 91668036 |
| Molecular Formula | C12H30N2O16P4 |
| Molecular Weight | 582.27 g/mol |
| Exact Mass | 582.05 |
| IUPAC Name | bis(2-[bis(2-hydroxyethyl)amino]ethanol);2,4,6,8,9,10-hexaoxa-1λ5,3λ5,5λ5,7λ5-tetraphosphatricyclo[3.3.1.13,7]decane 1,3,5,7-tetraoxide |
| SMILES | O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3.OCCN(CCO)CCO.OCCN(CCO)CCO |
| InChI | InChI=1S/2C6H15NO3.O10P4/c2*8-4-1-7(2-5-9)3-6-10;1-11-5-12(2)8-13(3,6-11)10-14(4,7-11)9-12/h2*8-10H,1-6H2; |
| InChIKey | IBRPFWFINFEQIC-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 251.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.27 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|