C30H52N2O3 — CID 91692849
2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)-3,3-dimethylbutanamide (PubChem CID 91692849) has the molecular formula C30H52N2O3 and a molecular weight of 488.76 g/mol. Its IUPAC name is 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)-3,3-dimethylbutanamide.
| Compound Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 91692849 |
| Molecular Formula | C30H52N2O3 |
| Molecular Weight | 488.76 g/mol |
| Exact Mass | 488.40 |
| IUPAC Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)-3,3-dimethylbutanamide |
| SMILES | CCC(C)(C)c1ccc(OC(C(=O)NC2CC(C)(C)N(O)C2(C)C)C(C)(C)C)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C30H52N2O3/c1-14-27(6,7)20-16-17-22(21(18-20)28(8,9)15-2)35-24(26(3,4)5)25(33)31-23-19-29(10,11)32(34)30(23,12)13/h16-18,23-24,34H,14-15,19H2,1-13H3,(H,31,33) |
| InChIKey | VGJCMHZNIMIUKV-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.76 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |