C33H42O5SSi — CID 91699896
[(3aR,4S,6S,7S,7aS)-2,2-dimethyl-6-methylsulfanyl-7-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 91699896) has the molecular formula C33H42O5SSi and a molecular weight of 578.85 g/mol. Its IUPAC name is [(3aR,4S,6S,7S,7aS)-2,2-dimethyl-6-methylsulfanyl-7-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aR,4S,6S,7S,7aS)-2,2-dimethyl-6-methylsulfanyl-7-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 91699896 |
| Molecular Formula | C33H42O5SSi |
| Molecular Weight | 578.85 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | [(3aR,4S,6S,7S,7aS)-2,2-dimethyl-6-methylsulfanyl-7-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CS[C@@H]1O[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]2OC(C)(C)O[C@@H]2[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C33H42O5SSi/c1-32(2,3)40(25-18-12-8-13-19-25,26-20-14-9-15-21-26)35-23-27-28-29(38-33(4,5)37-28)30(31(36-27)39-6)34-22-24-16-10-7-11-17-24/h7-21,27-31H,22-23H2,1-6H3/t27-,28+,29-,30-,31-/m0/s1 |
| InChIKey | DOZDOFSMBOJZKS-JZVHMONDSA-N |
| XLogP | 5.76 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.85 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|