C14H9F7O2Si — CID 91743682
trimethylsilyl 1,3,4,5,6,7,8-heptafluoronaphthalene-2-carboxylate (PubChem CID 91743682) has the molecular formula C14H9F7O2Si and a molecular weight of 370.30 g/mol. Its IUPAC name is trimethylsilyl 1,3,4,5,6,7,8-heptafluoronaphthalene-2-carboxylate.
| Compound Name | trimethylsilyl 1,3,4,5,6,7,8-heptafluoronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 91743682 |
| Molecular Formula | C14H9F7O2Si |
| Molecular Weight | 370.30 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | trimethylsilyl 1,3,4,5,6,7,8-heptafluoronaphthalene-2-carboxylate |
| SMILES | C[Si](C)(C)OC(=O)c1c(F)c(F)c2c(F)c(F)c(F)c(F)c2c1F |
| InChI | InChI=1S/C14H9F7O2Si/c1-24(2,3)23-14(22)6-7(15)4-5(8(16)11(6)19)10(18)13(21)12(20)9(4)17/h1-3H3 |
| InChIKey | QHKPCUVTSCOULE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.30 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|