C15H16FNO4S2 — CID 91775771
N-[(3R,4S)-4-(3-fluorophenoxy)oxan-3-yl]thiophene-2-sulfonamide (PubChem CID 91775771) has the molecular formula C15H16FNO4S2 and a molecular weight of 357.43 g/mol. Its IUPAC name is N-[(3R,4S)-4-(3-fluorophenoxy)oxan-3-yl]thiophene-2-sulfonamide.
| Compound Name | N-[(3R,4S)-4-(3-fluorophenoxy)oxan-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 91775771 |
| Molecular Formula | C15H16FNO4S2 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | N-[(3R,4S)-4-(3-fluorophenoxy)oxan-3-yl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(N[C@@H]1COCC[C@@H]1Oc1cccc(F)c1)c1cccs1 |
| InChI | InChI=1S/C15H16FNO4S2/c16-11-3-1-4-12(9-11)21-14-6-7-20-10-13(14)17-23(18,19)15-5-2-8-22-15/h1-5,8-9,13-14,17H,6-7,10H2/t13-,14+/m1/s1 |
| InChIKey | ZWOQLJKRIKTXQI-KGLIPLIRSA-N |
| XLogP | 2.40 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |