C27H28F5N3O2+2 — CID 91807468
1-methyl-6-[2,6,6-triethyl-9,11-difluoro-10-(trifluoromethyl)-7H-benzo[a]quinolizin-5-ium-7-yl]-5,6-dihydroimidazo[2,1-c][1,4]oxazin-1-ium-8-one (PubChem CID 91807468) has the molecular formula C27H28F5N3O2+2 and a molecular weight of 521.53 g/mol. Its IUPAC name is 1-methyl-6-[2,6,6-triethyl-9,11-difluoro-10-(trifluoromethyl)-7H-benzo[a]quinolizin-5-ium-7-yl]-5,6-dihydroimidazo[2,1-c][1,4]oxazin-1-ium-8-one.
| Compound Name | 1-methyl-6-[2,6,6-triethyl-9,11-difluoro-10-(trifluoromethyl)-7H-benzo[a]quinolizin-5-ium-7-yl]-5,6-dihydroimidazo[2,1-c][1,4]oxazin-1-ium-8-one |
|---|---|
| PubChem CID | 91807468 |
| Molecular Formula | C27H28F5N3O2+2 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | 1-methyl-6-[2,6,6-triethyl-9,11-difluoro-10-(trifluoromethyl)-7H-benzo[a]quinolizin-5-ium-7-yl]-5,6-dihydroimidazo[2,1-c][1,4]oxazin-1-ium-8-one |
| SMILES | CCc1cc[n+]2c(c1)-c1c(cc(F)c(C(F)(F)F)c1F)C(C1Cn3cc[n+](C)c3C(=O)O1)C2(CC)CC |
| InChI | InChI=1S/C27H28F5N3O2/c1-5-15-8-9-35-18(12-15)20-16(13-17(28)22(23(20)29)27(30,31)32)21(26(35,6-2)7-3)19-14-34-11-10-33(4)24(34)25(36)37-19/h8-13,19,21H,5-7,14H2,1-4H3/q+2 |
| InChIKey | IBBWCYMUINJEMG-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 38.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|