C18H29N3O3S — CID 9327864
1-[(2,4-dimethoxybenzoyl)amino]-3-[(2S)-2-methylheptyl]thiourea (PubChem CID 9327864) has the molecular formula C18H29N3O3S and a molecular weight of 367.52 g/mol. Its IUPAC name is 1-[(2,4-dimethoxybenzoyl)amino]-3-[(2S)-2-methylheptyl]thiourea.
| Compound Name | 1-[(2,4-dimethoxybenzoyl)amino]-3-[(2S)-2-methylheptyl]thiourea |
|---|---|
| PubChem CID | 9327864 |
| Molecular Formula | C18H29N3O3S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 1-[(2,4-dimethoxybenzoyl)amino]-3-[(2S)-2-methylheptyl]thiourea |
| SMILES | CCCCC[C@H](C)CNC(=S)NNC(=O)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C18H29N3O3S/c1-5-6-7-8-13(2)12-19-18(25)21-20-17(22)15-10-9-14(23-3)11-16(15)24-4/h9-11,13H,5-8,12H2,1-4H3,(H,20,22)(H2,19,21,25)/t13-/m0/s1 |
| InChIKey | NCHBFLIJHIYUPD-ZDUSSCGKSA-N |
| XLogP | 3.03 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|